C18H40N2O3 — CID 171540702
N,2-dimethylpropanamide;ethane;4-(2-pentoxyethyl)morpholine (PubChem CID 171540702) has the molecular formula C18H40N2O3 and a molecular weight of 332.53 g/mol. Its IUPAC name is N,2-dimethylpropanamide;ethane;4-(2-pentoxyethyl)morpholine.
| Compound Name | N,2-dimethylpropanamide;ethane;4-(2-pentoxyethyl)morpholine |
|---|---|
| PubChem CID | 171540702 |
| Molecular Formula | C18H40N2O3 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.30 |
| IUPAC Name | N,2-dimethylpropanamide;ethane;4-(2-pentoxyethyl)morpholine |
| SMILES | CC.CCCCCOCCN1CCOCC1.CNC(=O)C(C)C |
| InChI | InChI=1S/C11H23NO2.C5H11NO.C2H6/c1-2-3-4-8-13-9-5-12-6-10-14-11-7-12;1-4(2)5(7)6-3;1-2/h2-11H2,1H3;4H,1-3H3,(H,6,7);1-2H3 |
| InChIKey | RWPHQKJFGIEZKH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|