C21H31F3N4O2S2 — CID 170584412
tert-butyl 5-[3-[4-(methylaminosulfanyl)-2-(trifluoromethylsulfanyl)anilino]propyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 170584412) has the molecular formula C21H31F3N4O2S2 and a molecular weight of 492.63 g/mol. Its IUPAC name is tert-butyl 5-[3-[4-(methylaminosulfanyl)-2-(trifluoromethylsulfanyl)anilino]propyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 5-[3-[4-(methylaminosulfanyl)-2-(trifluoromethylsulfanyl)anilino]propyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 170584412 |
| Molecular Formula | C21H31F3N4O2S2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | tert-butyl 5-[3-[4-(methylaminosulfanyl)-2-(trifluoromethylsulfanyl)anilino]propyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CNSc1ccc(NCCCN2CC3CC2CN3C(=O)OC(C)(C)C)c(SC(F)(F)F)c1 |
| InChI | InChI=1S/C21H31F3N4O2S2/c1-20(2,3)30-19(29)28-13-14-10-15(28)12-27(14)9-5-8-26-17-7-6-16(32-25-4)11-18(17)31-21(22,23)24/h6-7,11,14-15,25-26H,5,8-10,12-13H2,1-4H3 |
| InChIKey | HDGBEIBLYKJKIE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|