C33H50N4O11 — CID 170584791
N-[1-[3-[[3-(4-hydroxyanilino)-3-oxopropyl]amino]-3-oxopropoxy]-2-[[3-oxo-3-(3-oxopropylamino)propoxy]methyl]-3-(3-oxopropoxy)propan-2-yl]-6-methyl-5-oxoheptanamide (PubChem CID 170584791) has the molecular formula C33H50N4O11 and a molecular weight of 678.78 g/mol. Its IUPAC name is N-[1-[3-[[3-(4-hydroxyanilino)-3-oxopropyl]amino]-3-oxopropoxy]-2-[[3-oxo-3-(3-oxopropylamino)propoxy]methyl]-3-(3-oxopropoxy)propan-2-yl]-6-methyl-5-oxoheptanamide.
| Compound Name | N-[1-[3-[[3-(4-hydroxyanilino)-3-oxopropyl]amino]-3-oxopropoxy]-2-[[3-oxo-3-(3-oxopropylamino)propoxy]methyl]-3-(3-oxopropoxy)propan-2-yl]-6-methyl-5-oxoheptanamide |
|---|---|
| PubChem CID | 170584791 |
| Molecular Formula | C33H50N4O11 |
| Molecular Weight | 678.78 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | N-[1-[3-[[3-(4-hydroxyanilino)-3-oxopropyl]amino]-3-oxopropoxy]-2-[[3-oxo-3-(3-oxopropylamino)propoxy]methyl]-3-(3-oxopropoxy)propan-2-yl]-6-methyl-5-oxoheptanamide |
| SMILES | CC(C)C(=O)CCCC(=O)NC(COCCC=O)(COCCC(=O)NCCC=O)COCCC(=O)NCCC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C33H50N4O11/c1-25(2)28(41)6-3-7-32(45)37-33(22-46-19-5-18-39,23-47-20-13-29(42)34-15-4-17-38)24-48-21-14-30(43)35-16-12-31(44)36-26-8-10-27(40)11-9-26/h8-11,17-18,25,40H,3-7,12-16,19-24H2,1-2H3,(H,34,42)(H,35,43)(H,36,44)(H,37,45) |
| InChIKey | IWFWPTNKBFHRJG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 215.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.78 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|