C24H39N3O4 — CID 134386218
6-methyl-5-oxo-N-[6-oxo-6-[4-[(propan-2-ylamino)oxymethyl]anilino]hexyl]heptanamide (PubChem CID 134386218) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is 6-methyl-5-oxo-N-[6-oxo-6-[4-[(propan-2-ylamino)oxymethyl]anilino]hexyl]heptanamide.
| Compound Name | 6-methyl-5-oxo-N-[6-oxo-6-[4-[(propan-2-ylamino)oxymethyl]anilino]hexyl]heptanamide |
|---|---|
| PubChem CID | 134386218 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 6-methyl-5-oxo-N-[6-oxo-6-[4-[(propan-2-ylamino)oxymethyl]anilino]hexyl]heptanamide |
| SMILES | CC(C)NOCc1ccc(NC(=O)CCCCCNC(=O)CCCC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C24H39N3O4/c1-18(2)22(28)9-8-11-23(29)25-16-7-5-6-10-24(30)26-21-14-12-20(13-15-21)17-31-27-19(3)4/h12-15,18-19,27H,5-11,16-17H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | YLTPWZVZZRBWCY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|