C37H45N9O4 — CID 170586422
7-cyclopentyl-2-[4-[2-[4-[[3-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]methyl]piperazin-1-yl]ethoxy]anilino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 170586422) has the molecular formula C37H45N9O4 and a molecular weight of 679.83 g/mol. Its IUPAC name is 7-cyclopentyl-2-[4-[2-[4-[[3-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]methyl]piperazin-1-yl]ethoxy]anilino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 7-cyclopentyl-2-[4-[2-[4-[[3-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]methyl]piperazin-1-yl]ethoxy]anilino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 170586422 |
| Molecular Formula | C37H45N9O4 |
| Molecular Weight | 679.83 g/mol |
| Exact Mass | 679.36 |
| IUPAC Name | 7-cyclopentyl-2-[4-[2-[4-[[3-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]methyl]piperazin-1-yl]ethoxy]anilino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cnc(Nc3ccc(OCCN4CCN(Cc5cccc(N6CCC(=O)NC6=O)c5)CC4)cc3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C37H45N9O4/c1-42(2)35(48)32-23-27-24-38-36(41-34(27)46(32)29-7-3-4-8-29)39-28-10-12-31(13-11-28)50-21-20-43-16-18-44(19-17-43)25-26-6-5-9-30(22-26)45-15-14-33(47)40-37(45)49/h5-6,9-13,22-24,29H,3-4,7-8,14-21,25H2,1-2H3,(H,38,39,41)(H,40,47,49) |
| InChIKey | MFBCEKSMMWCKPR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |