C12H16F3N — CID 170587751
1-methyl-3-(2-methylidenebutyl)-4-(trifluoromethyl)-2H-pyridine (PubChem CID 170587751) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is 1-methyl-3-(2-methylidenebutyl)-4-(trifluoromethyl)-2H-pyridine.
| Compound Name | 1-methyl-3-(2-methylidenebutyl)-4-(trifluoromethyl)-2H-pyridine |
|---|---|
| PubChem CID | 170587751 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 1-methyl-3-(2-methylidenebutyl)-4-(trifluoromethyl)-2H-pyridine |
| SMILES | C=C(CC)CC1=C(C(F)(F)F)C=CN(C)C1 |
| InChI | InChI=1S/C12H16F3N/c1-4-9(2)7-10-8-16(3)6-5-11(10)12(13,14)15/h5-6H,2,4,7-8H2,1,3H3 |
| InChIKey | XFPSREPMCJEYDE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|