C17H13BrN2O3 — CID 170588330
2-[3-(5-bromonaphthalen-1-yl)-1-methyl-2,4-dioxopyrimidin-5-yl]acetaldehyde (PubChem CID 170588330) has the molecular formula C17H13BrN2O3 and a molecular weight of 373.21 g/mol. Its IUPAC name is 2-[3-(5-bromonaphthalen-1-yl)-1-methyl-2,4-dioxopyrimidin-5-yl]acetaldehyde.
| Compound Name | 2-[3-(5-bromonaphthalen-1-yl)-1-methyl-2,4-dioxopyrimidin-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 170588330 |
| Molecular Formula | C17H13BrN2O3 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2-[3-(5-bromonaphthalen-1-yl)-1-methyl-2,4-dioxopyrimidin-5-yl]acetaldehyde |
| SMILES | Cn1cc(CC=O)c(=O)n(-c2cccc3c(Br)cccc23)c1=O |
| InChI | InChI=1S/C17H13BrN2O3/c1-19-10-11(8-9-21)16(22)20(17(19)23)15-7-3-4-12-13(15)5-2-6-14(12)18/h2-7,9-10H,8H2,1H3 |
| InChIKey | KKCAPROQWSPOIK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|