About 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine
1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine (PubChem CID 170588350) has the molecular formula C14H21F6N
and a molecular weight of 317.32 g/mol. Its IUPAC name is 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine.
Molecular Properties
| Compound Name | 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine |
| PubChem CID | 170588350 |
| Molecular Formula | C14H21F6N |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine |
| SMILES | CC(C)C1(C(F)(F)F)CCN(C(C2CC2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H21F6N/c1-9(2)12(14(18,19)20)5-7-21(8-6-12)11(10-3-4-10)13(15,16)17/h9-11H,3-8H2,1-2H3 |
| InChIKey | WHDZWZCSWBUAGS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine?
The IUPAC name of 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine (CID 170588350) is 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine.
What is the SMILES notation for 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine?
The canonical SMILES for 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine is CC(C)C1(C(F)(F)F)CCN(C(C2CC2)C(F)(F)F)CC1.
What is the InChIKey of 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine?
The InChIKey is WHDZWZCSWBUAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F6N/c1-9(2)12(14(18,19)20)5-7-21(8-6-12)11(10-3-4-10)13(15,16)17/h9-11H,3-8H2,1-2H3.
What are the key properties of 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine?
1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine has a molecular weight of 317.32 g/mol, XLogP of 4.63, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-propan-2-yl-4-(trifluoromethyl)piperidine is sourced from PubChem (CID 170588350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).