C13H22F3N — CID 170588923
5-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 170588923) has the molecular formula C13H22F3N and a molecular weight of 249.32 g/mol. Its IUPAC name is 5-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | 5-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 170588923 |
| Molecular Formula | C13H22F3N |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 5-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | CC(C)C1(C)CC2CN(CC(F)(F)F)CC2C1 |
| InChI | InChI=1S/C13H22F3N/c1-9(2)12(3)4-10-6-17(7-11(10)5-12)8-13(14,15)16/h9-11H,4-8H2,1-3H3 |
| InChIKey | VIEOPXSWPCQBOT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |