C33H45N5O8 — CID 170589997
2-[[[2-[[(2S)-6-(dimethylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]hexanoyl]amino]acetyl]amino]methoxy]acetic acid (PubChem CID 170589997) has the molecular formula C33H45N5O8 and a molecular weight of 639.75 g/mol. Its IUPAC name is 2-[[[2-[[(2S)-6-(dimethylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]hexanoyl]amino]acetyl]amino]methoxy]acetic acid.
| Compound Name | 2-[[[2-[[(2S)-6-(dimethylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]hexanoyl]amino]acetyl]amino]methoxy]acetic acid |
|---|---|
| PubChem CID | 170589997 |
| Molecular Formula | C33H45N5O8 |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | 2-[[[2-[[(2S)-6-(dimethylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]hexanoyl]amino]acetyl]amino]methoxy]acetic acid |
| SMILES | CC(C)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CCCCN(C)C)C(=O)NCC(=O)NCOCC(=O)O |
| InChI | InChI=1S/C33H45N5O8/c1-21(2)30(37-33(44)46-18-26-24-13-7-5-11-22(24)23-12-6-8-14-25(23)26)32(43)36-27(15-9-10-16-38(3)4)31(42)34-17-28(39)35-20-45-19-29(40)41/h5-8,11-14,21,26-27,30H,9-10,15-20H2,1-4H3,(H,34,42)(H,35,39)(H,36,43)(H,37,44)(H,40,41)/t27-,30-/m0/s1 |
| InChIKey | DXUSOHZDIKUPGM-FIBWVYCGSA-N |
| XLogP | 2.06 |
| TPSA | 175.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|