C32H36ClFN4O5S — CID 170590106
7-[4-[5-(3-amino-8-azabicyclo[3.2.1]octane-8-carbonyl)-3-(4-cyano-3-fluorophenyl)thiophen-2-yl]-2-hydroxyphenoxy]-N-hydroxyheptanamide;hydrochloride (PubChem CID 170590106) has the molecular formula C32H36ClFN4O5S and a molecular weight of 643.18 g/mol. Its IUPAC name is 7-[4-[5-(3-amino-8-azabicyclo[3.2.1]octane-8-carbonyl)-3-(4-cyano-3-fluorophenyl)thiophen-2-yl]-2-hydroxyphenoxy]-N-hydroxyheptanamide;hydrochloride.
| Compound Name | 7-[4-[5-(3-amino-8-azabicyclo[3.2.1]octane-8-carbonyl)-3-(4-cyano-3-fluorophenyl)thiophen-2-yl]-2-hydroxyphenoxy]-N-hydroxyheptanamide;hydrochloride |
|---|---|
| PubChem CID | 170590106 |
| Molecular Formula | C32H36ClFN4O5S |
| Molecular Weight | 643.18 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | 7-[4-[5-(3-amino-8-azabicyclo[3.2.1]octane-8-carbonyl)-3-(4-cyano-3-fluorophenyl)thiophen-2-yl]-2-hydroxyphenoxy]-N-hydroxyheptanamide;hydrochloride |
| SMILES | Cl.N#Cc1ccc(-c2cc(C(=O)N3C4CCC3CC(N)C4)sc2-c2ccc(OCCCCCCC(=O)NO)c(O)c2)cc1F |
| InChI | InChI=1S/C32H35FN4O5S.ClH/c33-26-13-19(6-7-21(26)18-34)25-17-29(32(40)37-23-9-10-24(37)16-22(35)15-23)43-31(25)20-8-11-28(27(38)14-20)42-12-4-2-1-3-5-30(39)36-41;/h6-8,11,13-14,17,22-24,38,41H,1-5,9-10,12,15-16,35H2,(H,36,39);1H |
| InChIKey | VNIBUWYCHISJOK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.18 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|