C14H17F3N6 — CID 170591954
4,6-dimethyl-14-(trifluoromethyl)-2,4,5,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3(7),5,13(17),14-pentaene (PubChem CID 170591954) has the molecular formula C14H17F3N6 and a molecular weight of 326.33 g/mol. Its IUPAC name is 4,6-dimethyl-14-(trifluoromethyl)-2,4,5,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3(7),5,13(17),14-pentaene.
| Compound Name | 4,6-dimethyl-14-(trifluoromethyl)-2,4,5,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3(7),5,13(17),14-pentaene |
|---|---|
| PubChem CID | 170591954 |
| Molecular Formula | C14H17F3N6 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4,6-dimethyl-14-(trifluoromethyl)-2,4,5,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3(7),5,13(17),14-pentaene |
| SMILES | Cc1nn(C)c2c1CCCCNc1nc(ncc1C(F)(F)F)N2 |
| InChI | InChI=1S/C14H17F3N6/c1-8-9-5-3-4-6-18-11-10(14(15,16)17)7-19-13(20-11)21-12(9)23(2)22-8/h7H,3-6H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | FBCDCEYSGADRIL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |