C32H35N5O5S — CID 170592162
methyl 2-[2-butyl-1-[[1-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]indol-3-yl]methyl]-4-methyl-6-oxopyrimidin-5-yl]acetate (PubChem CID 170592162) has the molecular formula C32H35N5O5S and a molecular weight of 601.73 g/mol. Its IUPAC name is methyl 2-[2-butyl-1-[[1-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]indol-3-yl]methyl]-4-methyl-6-oxopyrimidin-5-yl]acetate.
| Compound Name | methyl 2-[2-butyl-1-[[1-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]indol-3-yl]methyl]-4-methyl-6-oxopyrimidin-5-yl]acetate |
|---|---|
| PubChem CID | 170592162 |
| Molecular Formula | C32H35N5O5S |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | methyl 2-[2-butyl-1-[[1-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]indol-3-yl]methyl]-4-methyl-6-oxopyrimidin-5-yl]acetate |
| SMILES | CCCCc1nc(C)c(CC(=O)OC)c(=O)n1Cc1cn(-c2ccccc2SN(O)c2noc(C)c2C)c2ccccc12 |
| InChI | InChI=1S/C32H35N5O5S/c1-6-7-16-29-33-21(3)25(17-30(38)41-5)32(39)36(29)19-23-18-35(26-13-9-8-12-24(23)26)27-14-10-11-15-28(27)43-37(40)31-20(2)22(4)42-34-31/h8-15,18,40H,6-7,16-17,19H2,1-5H3 |
| InChIKey | DUDBZYHHXPIOAM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|