C22H24N2O5S — CID 170592275
methyl 4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-propoxybenzoate (PubChem CID 170592275) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is methyl 4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-propoxybenzoate.
| Compound Name | methyl 4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-propoxybenzoate |
|---|---|
| PubChem CID | 170592275 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | methyl 4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-propoxybenzoate |
| SMILES | CCCOc1cc(C(=O)OC)ccc1-c1ccccc1SN(O)c1noc(C)c1C |
| InChI | InChI=1S/C22H24N2O5S/c1-5-12-28-19-13-16(22(25)27-4)10-11-17(19)18-8-6-7-9-20(18)30-24(26)21-14(2)15(3)29-23-21/h6-11,13,26H,5,12H2,1-4H3 |
| InChIKey | GMHIHGWEXOAMLX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|