C32H32F3N3O4S — CID 170592192
1-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-3,3-dimethyl-6-(trifluoromethyl)indol-2-one (PubChem CID 170592192) has the molecular formula C32H32F3N3O4S and a molecular weight of 611.69 g/mol. Its IUPAC name is 1-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-3,3-dimethyl-6-(trifluoromethyl)indol-2-one.
| Compound Name | 1-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-3,3-dimethyl-6-(trifluoromethyl)indol-2-one |
|---|---|
| PubChem CID | 170592192 |
| Molecular Formula | C32H32F3N3O4S |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 1-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-3,3-dimethyl-6-(trifluoromethyl)indol-2-one |
| SMILES | CCOCc1cc(CN2C(=O)C(C)(C)c3ccc(C(F)(F)F)cc32)ccc1-c1ccccc1SN(O)c1noc(C)c1C |
| InChI | InChI=1S/C32H32F3N3O4S/c1-6-41-18-22-15-21(17-37-27-16-23(32(33,34)35)12-14-26(27)31(4,5)30(37)39)11-13-24(22)25-9-7-8-10-28(25)43-38(40)29-19(2)20(3)42-36-29/h7-16,40H,6,17-18H2,1-5H3 |
| InChIKey | IYWIRBXCZCGXCB-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|