C20H19BrN2O4S — CID 170592351
methyl 5-(bromomethyl)-2-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]benzoate (PubChem CID 170592351) has the molecular formula C20H19BrN2O4S and a molecular weight of 463.35 g/mol. Its IUPAC name is methyl 5-(bromomethyl)-2-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]benzoate.
| Compound Name | methyl 5-(bromomethyl)-2-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]benzoate |
|---|---|
| PubChem CID | 170592351 |
| Molecular Formula | C20H19BrN2O4S |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | methyl 5-(bromomethyl)-2-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]benzoate |
| SMILES | COC(=O)c1cc(CBr)ccc1-c1ccccc1SN(O)c1noc(C)c1C |
| InChI | InChI=1S/C20H19BrN2O4S/c1-12-13(2)27-22-19(12)23(25)28-18-7-5-4-6-16(18)15-9-8-14(11-21)10-17(15)20(24)26-3/h4-10,25H,11H2,1-3H3 |
| InChIKey | MCZAUALEXNRXJO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|