C31H35N5O4S — CID 170592334
[3-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-2-propylimidazo[4,5-b]pyridin-5-yl]methanol (PubChem CID 170592334) has the molecular formula C31H35N5O4S and a molecular weight of 573.72 g/mol. Its IUPAC name is [3-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-2-propylimidazo[4,5-b]pyridin-5-yl]methanol.
| Compound Name | [3-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-2-propylimidazo[4,5-b]pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 170592334 |
| Molecular Formula | C31H35N5O4S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | [3-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-2-propylimidazo[4,5-b]pyridin-5-yl]methanol |
| SMILES | CCCc1nc2ccc(CO)nc2n1Cc1ccc(-c2ccccc2SN(O)c2noc(C)c2C)c(COCC)c1 |
| InChI | InChI=1S/C31H35N5O4S/c1-5-9-29-33-27-15-13-24(18-37)32-31(27)35(29)17-22-12-14-25(23(16-22)19-39-6-2)26-10-7-8-11-28(26)41-36(38)30-20(3)21(4)40-34-30/h7-8,10-16,37-38H,5-6,9,17-19H2,1-4H3 |
| InChIKey | XOCDFEYGBMHDFR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|