C30H34BrN5O3S — CID 170592216
(Z)-1-amino-N-[2-[4-[(5-bromo-2-propylimidazo[4,5-b]pyridin-3-yl)methyl]-2-(ethoxymethyl)phenyl]phenyl]sulfanyl-3-hydroxy-2-methylbut-2-en-1-imine oxide (PubChem CID 170592216) has the molecular formula C30H34BrN5O3S and a molecular weight of 624.61 g/mol. Its IUPAC name is (Z)-1-amino-N-[2-[4-[(5-bromo-2-propylimidazo[4,5-b]pyridin-3-yl)methyl]-2-(ethoxymethyl)phenyl]phenyl]sulfanyl-3-hydroxy-2-methylbut-2-en-1-imine oxide.
| Compound Name | (Z)-1-amino-N-[2-[4-[(5-bromo-2-propylimidazo[4,5-b]pyridin-3-yl)methyl]-2-(ethoxymethyl)phenyl]phenyl]sulfanyl-3-hydroxy-2-methylbut-2-en-1-imine oxide |
|---|---|
| PubChem CID | 170592216 |
| Molecular Formula | C30H34BrN5O3S |
| Molecular Weight | 624.61 g/mol |
| Exact Mass | 623.16 |
| IUPAC Name | (Z)-1-amino-N-[2-[4-[(5-bromo-2-propylimidazo[4,5-b]pyridin-3-yl)methyl]-2-(ethoxymethyl)phenyl]phenyl]sulfanyl-3-hydroxy-2-methylbut-2-en-1-imine oxide |
| SMILES | CCCc1nc2ccc(Br)nc2n1Cc1ccc(-c2ccccc2S/[N+]([O-])=C(N)\C(C)=C(\C)O)c(COCC)c1 |
| InChI | InChI=1S/C30H34BrN5O3S/c1-5-9-28-33-25-14-15-27(31)34-30(25)35(28)17-21-12-13-23(22(16-21)18-39-6-2)24-10-7-8-11-26(24)40-36(38)29(32)19(3)20(4)37/h7-8,10-16,37H,5-6,9,17-18,32H2,1-4H3/b20-19-,36-29+ |
| InChIKey | QOCPMXRRPRMXCN-PATNGQCYSA-N |
| XLogP | 7.12 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.61 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|