C21H24N2O4S — CID 170592358
(Z)-1-amino-N-[2-[2-(ethoxymethyl)-4-formylphenyl]phenyl]sulfanyl-3-hydroxy-2-methylbut-2-en-1-imine oxide (PubChem CID 170592358) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is (Z)-1-amino-N-[2-[2-(ethoxymethyl)-4-formylphenyl]phenyl]sulfanyl-3-hydroxy-2-methylbut-2-en-1-imine oxide.
| Compound Name | (Z)-1-amino-N-[2-[2-(ethoxymethyl)-4-formylphenyl]phenyl]sulfanyl-3-hydroxy-2-methylbut-2-en-1-imine oxide |
|---|---|
| PubChem CID | 170592358 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (Z)-1-amino-N-[2-[2-(ethoxymethyl)-4-formylphenyl]phenyl]sulfanyl-3-hydroxy-2-methylbut-2-en-1-imine oxide |
| SMILES | CCOCc1cc(C=O)ccc1-c1ccccc1S/[N+]([O-])=C(N)\C(C)=C(\C)O |
| InChI | InChI=1S/C21H24N2O4S/c1-4-27-13-17-11-16(12-24)9-10-18(17)19-7-5-6-8-20(19)28-23(26)21(22)14(2)15(3)25/h5-12,25H,4,13,22H2,1-3H3/b15-14-,23-21+ |
| InChIKey | NIBGFLLLYSZJAK-UOHUNKCKSA-N |
| XLogP | 4.43 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|