C19H27N3O5 — CID 123930582
2,6-bis(ethoxymethyl)-4-(2-phenylhydrazinyl)phenol;nitromethane (PubChem CID 123930582) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2,6-bis(ethoxymethyl)-4-(2-phenylhydrazinyl)phenol;nitromethane.
| Compound Name | 2,6-bis(ethoxymethyl)-4-(2-phenylhydrazinyl)phenol;nitromethane |
|---|---|
| PubChem CID | 123930582 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2,6-bis(ethoxymethyl)-4-(2-phenylhydrazinyl)phenol;nitromethane |
| SMILES | CCOCc1cc(NNc2ccccc2)cc(COCC)c1O.C[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N2O3.CH3NO2/c1-3-22-12-14-10-17(11-15(18(14)21)13-23-4-2)20-19-16-8-6-5-7-9-16;1-2(3)4/h5-11,19-21H,3-4,12-13H2,1-2H3;1H3 |
| InChIKey | OICGUIPYYBNIDZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|