C37H52O8 — CID 59541081
4-[1,1-bis[3,5-bis(ethoxymethyl)-4-hydroxyphenyl]ethyl]-2-(ethoxymethyl)-6-ethylphenol (PubChem CID 59541081) has the molecular formula C37H52O8 and a molecular weight of 624.82 g/mol. Its IUPAC name is 4-[1,1-bis[3,5-bis(ethoxymethyl)-4-hydroxyphenyl]ethyl]-2-(ethoxymethyl)-6-ethylphenol.
| Compound Name | 4-[1,1-bis[3,5-bis(ethoxymethyl)-4-hydroxyphenyl]ethyl]-2-(ethoxymethyl)-6-ethylphenol |
|---|---|
| PubChem CID | 59541081 |
| Molecular Formula | C37H52O8 |
| Molecular Weight | 624.82 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | 4-[1,1-bis[3,5-bis(ethoxymethyl)-4-hydroxyphenyl]ethyl]-2-(ethoxymethyl)-6-ethylphenol |
| SMILES | CCOCc1cc(C(C)(c2cc(COCC)c(O)c(COCC)c2)c2cc(COCC)c(O)c(COCC)c2)cc(CC)c1O |
| InChI | InChI=1S/C37H52O8/c1-8-25-14-31(15-26(34(25)38)20-41-9-2)37(7,32-16-27(21-42-10-3)35(39)28(17-32)22-43-11-4)33-18-29(23-44-12-5)36(40)30(19-33)24-45-13-6/h14-19,38-40H,8-13,20-24H2,1-7H3 |
| InChIKey | WWZNZGITNCRNAG-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.82 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|