C32H38O9 — CID 137470495
2-[5-[1,1-bis[4-hydroxy-3,5-bis(methoxymethyl)phenyl]ethyl]-2-hydroxy-3-(2-oxoethyl)phenyl]acetaldehyde (PubChem CID 137470495) has the molecular formula C32H38O9 and a molecular weight of 566.65 g/mol. Its IUPAC name is 2-[5-[1,1-bis[4-hydroxy-3,5-bis(methoxymethyl)phenyl]ethyl]-2-hydroxy-3-(2-oxoethyl)phenyl]acetaldehyde.
| Compound Name | 2-[5-[1,1-bis[4-hydroxy-3,5-bis(methoxymethyl)phenyl]ethyl]-2-hydroxy-3-(2-oxoethyl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 137470495 |
| Molecular Formula | C32H38O9 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 2-[5-[1,1-bis[4-hydroxy-3,5-bis(methoxymethyl)phenyl]ethyl]-2-hydroxy-3-(2-oxoethyl)phenyl]acetaldehyde |
| SMILES | COCc1cc(C(C)(c2cc(CC=O)c(O)c(CC=O)c2)c2cc(COC)c(O)c(COC)c2)cc(COC)c1O |
| InChI | InChI=1S/C32H38O9/c1-32(26-10-20(6-8-33)29(35)21(11-26)7-9-34,27-12-22(16-38-2)30(36)23(13-27)17-39-3)28-14-24(18-40-4)31(37)25(15-28)19-41-5/h8-15,35-37H,6-7,16-19H2,1-5H3 |
| InChIKey | LXYRGDPOEKGLCZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|