C21H26O3Y2-2 — CID 59663900
2-ethyl-6-[[2-hydroxy-5-methanidyl-3-(propoxymethyl)phenyl]methyl]-4-methanidylphenol;bis(yttrium) (PubChem CID 59663900) has the molecular formula C21H26O3Y2-2 and a molecular weight of 504.25 g/mol. Its IUPAC name is 2-ethyl-6-[[2-hydroxy-5-methanidyl-3-(propoxymethyl)phenyl]methyl]-4-methanidylphenol;bis(yttrium).
| Compound Name | 2-ethyl-6-[[2-hydroxy-5-methanidyl-3-(propoxymethyl)phenyl]methyl]-4-methanidylphenol;bis(yttrium) |
|---|---|
| PubChem CID | 59663900 |
| Molecular Formula | C21H26O3Y2-2 |
| Molecular Weight | 504.25 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | 2-ethyl-6-[[2-hydroxy-5-methanidyl-3-(propoxymethyl)phenyl]methyl]-4-methanidylphenol;bis(yttrium) |
| SMILES | [CH2-]c1cc(CC)c(O)c(Cc2cc([CH2-])cc(COCCC)c2O)c1.[Y].[Y] |
| InChI | InChI=1S/C21H26O3.2Y/c1-5-7-24-13-19-11-15(4)10-18(21(19)23)12-17-9-14(3)8-16(6-2)20(17)22;;/h8-11,22-23H,3-7,12-13H2,1-2H3;;/q-2;; |
| InChIKey | WWCSDFMONKWDEM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|