C20H22N4O8-2 — CID 163122597
1-ethoxy-2-[5-(2-ethoxy-2-oxoethyl)-2-[hydroxy(oxido)amino]-4-nitrophenyl]-2-(2-phenylhydrazinyl)ethenolate (PubChem CID 163122597) has the molecular formula C20H22N4O8-2 and a molecular weight of 446.42 g/mol. Its IUPAC name is 1-ethoxy-2-[5-(2-ethoxy-2-oxoethyl)-2-[hydroxy(oxido)amino]-4-nitrophenyl]-2-(2-phenylhydrazinyl)ethenolate.
| Compound Name | 1-ethoxy-2-[5-(2-ethoxy-2-oxoethyl)-2-[hydroxy(oxido)amino]-4-nitrophenyl]-2-(2-phenylhydrazinyl)ethenolate |
|---|---|
| PubChem CID | 163122597 |
| Molecular Formula | C20H22N4O8-2 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-ethoxy-2-[5-(2-ethoxy-2-oxoethyl)-2-[hydroxy(oxido)amino]-4-nitrophenyl]-2-(2-phenylhydrazinyl)ethenolate |
| SMILES | CCOC(=O)Cc1cc(C(NNc2ccccc2)=C([O-])OCC)c(N([O-])O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N4O8/c1-3-31-18(25)11-13-10-15(17(24(29)30)12-16(13)23(27)28)19(20(26)32-4-2)22-21-14-8-6-5-7-9-14/h5-10,12,21-22,26,29H,3-4,11H2,1-2H3/q-1/p-1 |
| InChIKey | PDGWXHQONSRLAO-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 172.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|