C34H39N5O7S — CID 170592249
5-[[2-butyl-4-methyl-5-(2-morpholin-4-yl-2-oxoethyl)-6-oxopyrimidin-1-yl]methyl]-2-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]benzoic acid (PubChem CID 170592249) has the molecular formula C34H39N5O7S and a molecular weight of 661.78 g/mol. Its IUPAC name is 5-[[2-butyl-4-methyl-5-(2-morpholin-4-yl-2-oxoethyl)-6-oxopyrimidin-1-yl]methyl]-2-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]benzoic acid.
| Compound Name | 5-[[2-butyl-4-methyl-5-(2-morpholin-4-yl-2-oxoethyl)-6-oxopyrimidin-1-yl]methyl]-2-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]benzoic acid |
|---|---|
| PubChem CID | 170592249 |
| Molecular Formula | C34H39N5O7S |
| Molecular Weight | 661.78 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | 5-[[2-butyl-4-methyl-5-(2-morpholin-4-yl-2-oxoethyl)-6-oxopyrimidin-1-yl]methyl]-2-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-hydroxyamino]sulfanylphenyl]benzoic acid |
| SMILES | CCCCc1nc(C)c(CC(=O)N2CCOCC2)c(=O)n1Cc1ccc(-c2ccccc2SN(O)c2noc(C)c2C)c(C(=O)O)c1 |
| InChI | InChI=1S/C34H39N5O7S/c1-5-6-11-30-35-22(3)27(19-31(40)37-14-16-45-17-15-37)33(41)38(30)20-24-12-13-25(28(18-24)34(42)43)26-9-7-8-10-29(26)47-39(44)32-21(2)23(4)46-36-32/h7-10,12-13,18,44H,5-6,11,14-17,19-20H2,1-4H3,(H,42,43) |
| InChIKey | GVSVVJCXGSQHMY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.78 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|