C35H48N4O4S — CID 142329752
N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(methoxymethyl)amino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-N'-(1-formylcyclopentyl)-N-methylpentanimidamide (PubChem CID 142329752) has the molecular formula C35H48N4O4S and a molecular weight of 620.86 g/mol. Its IUPAC name is N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(methoxymethyl)amino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-N'-(1-formylcyclopentyl)-N-methylpentanimidamide.
| Compound Name | N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(methoxymethyl)amino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-N'-(1-formylcyclopentyl)-N-methylpentanimidamide |
|---|---|
| PubChem CID | 142329752 |
| Molecular Formula | C35H48N4O4S |
| Molecular Weight | 620.86 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(methoxymethyl)amino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-N'-(1-formylcyclopentyl)-N-methylpentanimidamide |
| SMILES | CCCC/C(=N\C1(C=O)CCCC1)N(C)Cc1ccc(-c2ccccc2SN(COC)c2noc(C)c2C)c(COCC)c1 |
| InChI | InChI=1S/C35H48N4O4S/c1-7-9-16-33(36-35(24-40)19-12-13-20-35)38(5)22-28-17-18-30(29(21-28)23-42-8-2)31-14-10-11-15-32(31)44-39(25-41-6)34-26(3)27(4)43-37-34/h10-11,14-15,17-18,21,24H,7-9,12-13,16,19-20,22-23,25H2,1-6H3/b36-33+ |
| InChIKey | XMJCVTAVZGLKEX-PKUSAGTQSA-N |
| XLogP | 8.14 |
| TPSA | 80.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.86 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|