C33H44N4O5S — CID 174350359
N-[C-butyl-N-(1-methylcyclopentyl)carbonimidoyl]-N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-3-propoxyphenyl]methyl]formamide (PubChem CID 174350359) has the molecular formula C33H44N4O5S and a molecular weight of 608.81 g/mol. Its IUPAC name is N-[C-butyl-N-(1-methylcyclopentyl)carbonimidoyl]-N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-3-propoxyphenyl]methyl]formamide.
| Compound Name | N-[C-butyl-N-(1-methylcyclopentyl)carbonimidoyl]-N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-3-propoxyphenyl]methyl]formamide |
|---|---|
| PubChem CID | 174350359 |
| Molecular Formula | C33H44N4O5S |
| Molecular Weight | 608.81 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | N-[C-butyl-N-(1-methylcyclopentyl)carbonimidoyl]-N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-3-propoxyphenyl]methyl]formamide |
| SMILES | CCCC/C(=N\C1(C)CCCC1)N(C=O)Cc1ccc(-c2ccccc2S(=O)(=O)Nc2noc(C)c2C)c(OCCC)c1 |
| InChI | InChI=1S/C33H44N4O5S/c1-6-8-15-31(34-33(5)18-11-12-19-33)37(23-38)22-26-16-17-27(29(21-26)41-20-7-2)28-13-9-10-14-30(28)43(39,40)36-32-24(3)25(4)42-35-32/h9-10,13-14,16-17,21,23H,6-8,11-12,15,18-20,22H2,1-5H3,(H,35,36)/b34-31+ |
| InChIKey | CQVYWUNKVWPBIP-WUVHBKSUSA-N |
| XLogP | 7.43 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.81 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|