C26H32N2O8S — CID 167442621
methyl 4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenyl]-3-(ethoxymethyl)benzoate (PubChem CID 167442621) has the molecular formula C26H32N2O8S and a molecular weight of 532.62 g/mol. Its IUPAC name is methyl 4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenyl]-3-(ethoxymethyl)benzoate.
| Compound Name | methyl 4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenyl]-3-(ethoxymethyl)benzoate |
|---|---|
| PubChem CID | 167442621 |
| Molecular Formula | C26H32N2O8S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | methyl 4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenyl]-3-(ethoxymethyl)benzoate |
| SMILES | CCOCc1cc(C(=O)OC)ccc1-c1ccccc1S(=O)(=O)N(COCCOC)c1noc(C)c1C |
| InChI | InChI=1S/C26H32N2O8S/c1-6-34-16-21-15-20(26(29)33-5)11-12-22(21)23-9-7-8-10-24(23)37(30,31)28(17-35-14-13-32-4)25-18(2)19(3)36-27-25/h7-12,15H,6,13-14,16-17H2,1-5H3 |
| InChIKey | GVUYRXNOWIKPFI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 117.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|