C25H31FN2O7S — CID 22574824
N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[2-(2-fluoroethoxymethyl)-4-(hydroxymethyl)phenyl]-N-(2-methoxyethoxymethyl)benzenesulfonamide (PubChem CID 22574824) has the molecular formula C25H31FN2O7S and a molecular weight of 522.60 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[2-(2-fluoroethoxymethyl)-4-(hydroxymethyl)phenyl]-N-(2-methoxyethoxymethyl)benzenesulfonamide.
| Compound Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[2-(2-fluoroethoxymethyl)-4-(hydroxymethyl)phenyl]-N-(2-methoxyethoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22574824 |
| Molecular Formula | C25H31FN2O7S |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[2-(2-fluoroethoxymethyl)-4-(hydroxymethyl)phenyl]-N-(2-methoxyethoxymethyl)benzenesulfonamide |
| SMILES | COCCOCN(c1noc(C)c1C)S(=O)(=O)c1ccccc1-c1ccc(CO)cc1COCCF |
| InChI | InChI=1S/C25H31FN2O7S/c1-18-19(2)35-27-25(18)28(17-34-13-12-32-3)36(30,31)24-7-5-4-6-23(24)22-9-8-20(15-29)14-21(22)16-33-11-10-26/h4-9,14,29H,10-13,15-17H2,1-3H3 |
| InChIKey | CMZOHSLCJLJGEP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|