C24H23N3O3S — CID 170592723
N-[4-[(8-methoxy-1,7-naphthyridin-4-yl)oxy]phenyl]sulfanyl-1-(4-methoxyphenyl)ethanamine (PubChem CID 170592723) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[4-[(8-methoxy-1,7-naphthyridin-4-yl)oxy]phenyl]sulfanyl-1-(4-methoxyphenyl)ethanamine.
| Compound Name | N-[4-[(8-methoxy-1,7-naphthyridin-4-yl)oxy]phenyl]sulfanyl-1-(4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 170592723 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-[4-[(8-methoxy-1,7-naphthyridin-4-yl)oxy]phenyl]sulfanyl-1-(4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(C(C)NSc2ccc(Oc3ccnc4c(OC)nccc34)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O3S/c1-16(17-4-6-18(28-2)7-5-17)27-31-20-10-8-19(9-11-20)30-22-13-15-25-23-21(22)12-14-26-24(23)29-3/h4-16,27H,1-3H3 |
| InChIKey | HTBCPZCMBYVKHZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|