C15H12N3O3S- — CID 170415309
CID 170415309 (PubChem CID 170415309) has the molecular formula C15H12N3O3S- and a molecular weight of 314.35 g/mol.
| Compound Name | CID 170415309 |
|---|---|
| PubChem CID | 170415309 |
| Molecular Formula | C15H12N3O3S- |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1ccc(Oc2ccnc3c(OC)nccc23)cc1 |
| InChI | InChI=1S/C15H12N3O3S/c1-20-15-14-12(6-8-18-15)13(7-9-17-14)21-10-2-4-11(5-3-10)22(16)19/h2-9,16H,1H3/q-1 |
| InChIKey | ZGNWKDBCXMAAEV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|