C21H27ClFN5O3S — CID 170594287
tert-butyl (7S,8S)-12-chloro-6-ethyl-13-fluoro-8-methyl-16-methylsulfanyl-9-oxa-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate (PubChem CID 170594287) has the molecular formula C21H27ClFN5O3S and a molecular weight of 484.00 g/mol. Its IUPAC name is tert-butyl (7S,8S)-12-chloro-6-ethyl-13-fluoro-8-methyl-16-methylsulfanyl-9-oxa-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate.
| Compound Name | tert-butyl (7S,8S)-12-chloro-6-ethyl-13-fluoro-8-methyl-16-methylsulfanyl-9-oxa-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 170594287 |
| Molecular Formula | C21H27ClFN5O3S |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | tert-butyl (7S,8S)-12-chloro-6-ethyl-13-fluoro-8-methyl-16-methylsulfanyl-9-oxa-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate |
| SMILES | CCC1[C@H]2[C@H](C)Oc3nc(Cl)c(F)c4nc(SC)nc(c34)N2CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H27ClFN5O3S/c1-7-11-15-10(2)30-18-12-14(13(23)16(22)25-18)24-19(32-6)26-17(12)28(15)9-8-27(11)20(29)31-21(3,4)5/h10-11,15H,7-9H2,1-6H3/t10-,11?,15+/m0/s1 |
| InChIKey | NEEBHTGYNSWFFR-ZYTVVRLJSA-N |
| XLogP | 4.52 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|