C21H16Cl3NO3 — CID 17059529
4-chloro-3-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylamino]benzoic acid (PubChem CID 17059529) has the molecular formula C21H16Cl3NO3 and a molecular weight of 436.72 g/mol. Its IUPAC name is 4-chloro-3-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylamino]benzoic acid.
| Compound Name | 4-chloro-3-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 17059529 |
| Molecular Formula | C21H16Cl3NO3 |
| Molecular Weight | 436.72 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 4-chloro-3-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(NCc2cc(Cl)ccc2OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H16Cl3NO3/c22-16-4-1-13(2-5-16)12-28-20-8-6-17(23)9-15(20)11-25-19-10-14(21(26)27)3-7-18(19)24/h1-10,25H,11-12H2,(H,26,27) |
| InChIKey | QHVJBBUBDBLDEN-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |