C12H20O5 — CID 170596753
2-[(2S,5R)-2-methyl-5-(2-methylprop-2-enoxy)oxan-3-yl]oxyacetic acid (PubChem CID 170596753) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[(2S,5R)-2-methyl-5-(2-methylprop-2-enoxy)oxan-3-yl]oxyacetic acid.
| Compound Name | 2-[(2S,5R)-2-methyl-5-(2-methylprop-2-enoxy)oxan-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 170596753 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[(2S,5R)-2-methyl-5-(2-methylprop-2-enoxy)oxan-3-yl]oxyacetic acid |
| SMILES | C=C(C)CO[C@H]1CO[C@@H](C)C(OCC(=O)O)C1 |
| InChI | InChI=1S/C12H20O5/c1-8(2)5-16-10-4-11(9(3)15-6-10)17-7-12(13)14/h9-11H,1,4-7H2,2-3H3,(H,13,14)/t9-,10+,11?/m0/s1 |
| InChIKey | RIVOLHDSKKTDSL-MTULOOOASA-N |
| XLogP | 1.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|