C44H58BN10O2S — CID 170597034
CID 170597034 (PubChem CID 170597034) has the molecular formula C44H58BN10O2S and a molecular weight of 801.90 g/mol.
| Compound Name | CID 170597034 |
|---|---|
| PubChem CID | 170597034 |
| Molecular Formula | C44H58BN10O2S |
| Molecular Weight | 801.90 g/mol |
| Exact Mass | 801.46 |
| IUPAC Name | — |
| SMILES | [B].[H]/N=C1C(=C(C)\C(N)=N\c2nc3ccccc3s2)/CCCN/1C1=CC=C(c2cnn(CC34CC5(C)CC(C)(C3)CC(OCCN3CCCC3)(C5)C4)c2C)/C(=C(/N)O)N1 |
| InChI | InChI=1S/C44H58N10O2S.B/c1-28(37(45)51-40-49-33-11-5-6-12-34(33)57-40)30-10-9-17-53(38(30)46)35-14-13-31(36(50-35)39(47)55)32-20-48-54(29(32)2)27-43-22-41(3)21-42(4,23-43)25-44(24-41,26-43)56-19-18-52-15-7-8-16-52;/h5-6,11-14,20,46,50,55H,7-10,15-19,21-27,47H2,1-4H3,(H2,45,49,51);/b30-28-,39-36+,46-38-; |
| InChIKey | IOXSIQKOWBFKMP-NGUMSVLKSA-N |
| XLogP | 7.24 |
| TPSA | 166.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.90 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|