C15H34N4O3 — CID 170598149
N-(2-amino-2-oxoethyl)-4-methyl-2-(propanoylamino)pentanamide;ethanamine;ethane (PubChem CID 170598149) has the molecular formula C15H34N4O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-methyl-2-(propanoylamino)pentanamide;ethanamine;ethane.
| Compound Name | N-(2-amino-2-oxoethyl)-4-methyl-2-(propanoylamino)pentanamide;ethanamine;ethane |
|---|---|
| PubChem CID | 170598149 |
| Molecular Formula | C15H34N4O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-methyl-2-(propanoylamino)pentanamide;ethanamine;ethane |
| SMILES | CC.CCC(=O)NC(CC(C)C)C(=O)NCC(N)=O.CCN |
| InChI | InChI=1S/C11H21N3O3.C2H7N.C2H6/c1-4-10(16)14-8(5-7(2)3)11(17)13-6-9(12)15;1-2-3;1-2/h7-8H,4-6H2,1-3H3,(H2,12,15)(H,13,17)(H,14,16);2-3H2,1H3;1-2H3 |
| InChIKey | DMSUEUGMECFHCT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |