About CID 170598433
CID 170598433 (PubChem CID 170598433) has the molecular formula C13H22NO3Pb
and a molecular weight of 447.52 g/mol.
Molecular Properties
| Compound Name | CID 170598433 |
| PubChem CID | 170598433 |
| Molecular Formula | C13H22NO3Pb |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | — |
| SMILES | CC(C)(CC(=O)OC(C)(C)C)CC1=NC([Pb])CO1 |
| InChI | InChI=1S/C13H22NO3.Pb/c1-12(2,3)17-11(15)9-13(4,5)8-10-14-6-7-16-10;/h6H,7-9H2,1-5H3; |
| InChIKey | LOYWGWIRVRNTPI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 170598433 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170598433?
The IUPAC name of CID 170598433 (CID 170598433) is not available.
What is the SMILES notation for CID 170598433?
The canonical SMILES for CID 170598433 is CC(C)(CC(=O)OC(C)(C)C)CC1=NC([Pb])CO1.
What is the InChIKey of CID 170598433?
The InChIKey is LOYWGWIRVRNTPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22NO3.Pb/c1-12(2,3)17-11(15)9-13(4,5)8-10-14-6-7-16-10;/h6H,7-9H2,1-5H3;.
What are the key properties of CID 170598433?
CID 170598433 has a molecular weight of 447.52 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170598433 is sourced from PubChem (CID 170598433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).