C18H22BrNO3 — CID 170598826
benzyl N-(3-bromo-2-oxo-1-spiro[3.3]heptan-2-ylpropyl)carbamate (PubChem CID 170598826) has the molecular formula C18H22BrNO3 and a molecular weight of 380.28 g/mol. Its IUPAC name is benzyl N-(3-bromo-2-oxo-1-spiro[3.3]heptan-2-ylpropyl)carbamate.
| Compound Name | benzyl N-(3-bromo-2-oxo-1-spiro[3.3]heptan-2-ylpropyl)carbamate |
|---|---|
| PubChem CID | 170598826 |
| Molecular Formula | C18H22BrNO3 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | benzyl N-(3-bromo-2-oxo-1-spiro[3.3]heptan-2-ylpropyl)carbamate |
| SMILES | O=C(NC(C(=O)CBr)C1CC2(CCC2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C18H22BrNO3/c19-11-15(21)16(14-9-18(10-14)7-4-8-18)20-17(22)23-12-13-5-2-1-3-6-13/h1-3,5-6,14,16H,4,7-12H2,(H,20,22) |
| InChIKey | JGQLDESLHFSAJZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|