C23H25NO4S — CID 170599515
N-[4-(hydroxymethyl)oxan-4-yl]-2-methyl-5-phenylmethoxy-1-benzothiophene-3-carboxamide (PubChem CID 170599515) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)oxan-4-yl]-2-methyl-5-phenylmethoxy-1-benzothiophene-3-carboxamide.
| Compound Name | N-[4-(hydroxymethyl)oxan-4-yl]-2-methyl-5-phenylmethoxy-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 170599515 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-[4-(hydroxymethyl)oxan-4-yl]-2-methyl-5-phenylmethoxy-1-benzothiophene-3-carboxamide |
| SMILES | Cc1sc2ccc(OCc3ccccc3)cc2c1C(=O)NC1(CO)CCOCC1 |
| InChI | InChI=1S/C23H25NO4S/c1-16-21(22(26)24-23(15-25)9-11-27-12-10-23)19-13-18(7-8-20(19)29-16)28-14-17-5-3-2-4-6-17/h2-8,13,25H,9-12,14-15H2,1H3,(H,24,26) |
| InChIKey | DLYYXZCUEVDPDG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |