C23H27N3O4S — CID 170599603
formamide;2-methyl-N-(4-methyloxan-4-yl)-5-(pyridin-2-ylmethoxy)-1-benzothiophene-3-carboxamide (PubChem CID 170599603) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is formamide;2-methyl-N-(4-methyloxan-4-yl)-5-(pyridin-2-ylmethoxy)-1-benzothiophene-3-carboxamide.
| Compound Name | formamide;2-methyl-N-(4-methyloxan-4-yl)-5-(pyridin-2-ylmethoxy)-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 170599603 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | formamide;2-methyl-N-(4-methyloxan-4-yl)-5-(pyridin-2-ylmethoxy)-1-benzothiophene-3-carboxamide |
| SMILES | Cc1sc2ccc(OCc3ccccn3)cc2c1C(=O)NC1(C)CCOCC1.NC=O |
| InChI | InChI=1S/C22H24N2O3S.CH3NO/c1-15-20(21(25)24-22(2)8-11-26-12-9-22)18-13-17(6-7-19(18)28-15)27-14-16-5-3-4-10-23-16;2-1-3/h3-7,10,13H,8-9,11-12,14H2,1-2H3,(H,24,25);1H,(H2,2,3) |
| InChIKey | UIEASSGPDMCYSU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|