C20H26O6 — CID 170600746
7-[[(2S)-5-(hydroxymethyl)-4-methyl-3-propoxyoxolan-2-yl]methoxy]-4-methylchromen-2-one (PubChem CID 170600746) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is 7-[[(2S)-5-(hydroxymethyl)-4-methyl-3-propoxyoxolan-2-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[[(2S)-5-(hydroxymethyl)-4-methyl-3-propoxyoxolan-2-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 170600746 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 7-[[(2S)-5-(hydroxymethyl)-4-methyl-3-propoxyoxolan-2-yl]methoxy]-4-methylchromen-2-one |
| SMILES | CCCOC1C(C)C(CO)O[C@H]1COc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H26O6/c1-4-7-23-20-13(3)17(10-21)25-18(20)11-24-14-5-6-15-12(2)8-19(22)26-16(15)9-14/h5-6,8-9,13,17-18,20-21H,4,7,10-11H2,1-3H3/t13?,17?,18-,20?/m0/s1 |
| InChIKey | FLMMQYQNFFMPNP-OLZYVEHFSA-N |
| XLogP | 2.67 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|