C27H30BN3O4S — CID 170600803
1-[(E)-ethylidene-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-5-yl)-λ4-sulfanyl]-3-[5-(2-methoxy-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]urea (PubChem CID 170600803) has the molecular formula C27H30BN3O4S and a molecular weight of 503.43 g/mol. Its IUPAC name is 1-[(E)-ethylidene-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-5-yl)-λ4-sulfanyl]-3-[5-(2-methoxy-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]urea.
| Compound Name | 1-[(E)-ethylidene-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-5-yl)-λ4-sulfanyl]-3-[5-(2-methoxy-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]urea |
|---|---|
| PubChem CID | 170600803 |
| Molecular Formula | C27H30BN3O4S |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 1-[(E)-ethylidene-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-5-yl)-λ4-sulfanyl]-3-[5-(2-methoxy-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]urea |
| SMILES | C/C=S(/NC(=O)Nc1c(-c2ccnc(OC)c2)ccc2c1CCC2)c1ccc2c(c1)C(C)(C)OB2O |
| InChI | InChI=1S/C27H30BN3O4S/c1-5-36(19-10-12-23-22(16-19)27(2,3)35-28(23)33)31-26(32)30-25-20-8-6-7-17(20)9-11-21(25)18-13-14-29-24(15-18)34-4/h5,9-16,33H,6-8H2,1-4H3,(H2,30,31,32) |
| InChIKey | UQWVROHXFUEGJW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|