C25H24BN5O6S — CID 170600866
[3-[3-[[5-(2-methoxy-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]carbamoylsulfamoyl]pyrazol-1-yl]phenyl]boronic acid (PubChem CID 170600866) has the molecular formula C25H24BN5O6S and a molecular weight of 533.38 g/mol. Its IUPAC name is [3-[3-[[5-(2-methoxy-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]carbamoylsulfamoyl]pyrazol-1-yl]phenyl]boronic acid.
| Compound Name | [3-[3-[[5-(2-methoxy-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]carbamoylsulfamoyl]pyrazol-1-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 170600866 |
| Molecular Formula | C25H24BN5O6S |
| Molecular Weight | 533.38 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | [3-[3-[[5-(2-methoxy-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]carbamoylsulfamoyl]pyrazol-1-yl]phenyl]boronic acid |
| SMILES | COc1cc(-c2ccc3c(c2NC(=O)NS(=O)(=O)c2ccn(-c4cccc(B(O)O)c4)n2)CCC3)ccn1 |
| InChI | InChI=1S/C25H24BN5O6S/c1-37-22-14-17(10-12-27-22)21-9-8-16-4-2-7-20(16)24(21)28-25(32)30-38(35,36)23-11-13-31(29-23)19-6-3-5-18(15-19)26(33)34/h3,5-6,8-15,33-34H,2,4,7H2,1H3,(H2,28,30,32) |
| InChIKey | AGSREGDPJOODMU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|