C19H19N5NaO3S2 — CID 175859595
CID 175859595 (PubChem CID 175859595) has the molecular formula C19H19N5NaO3S2 and a molecular weight of 452.52 g/mol.
| Compound Name | CID 175859595 |
|---|---|
| PubChem CID | 175859595 |
| Molecular Formula | C19H19N5NaO3S2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | — |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)c1ccn(-c2nccs2)n1.[Na] |
| InChI | InChI=1S/C19H19N5O3S2.Na/c25-18(21-17-14-5-1-3-12(14)11-13-4-2-6-15(13)17)23-29(26,27)16-7-9-24(22-16)19-20-8-10-28-19;/h7-11H,1-6H2,(H2,21,23,25); |
| InChIKey | VKVPWXPWMCWEDX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |