C21H25BN4O5S — CID 170601005
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[1-[(2-hydroxy-5,6-dihydrooxaborinin-5-yl)methyl]pyrazol-3-yl]sulfonylurea (PubChem CID 170601005) has the molecular formula C21H25BN4O5S and a molecular weight of 456.33 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[1-[(2-hydroxy-5,6-dihydrooxaborinin-5-yl)methyl]pyrazol-3-yl]sulfonylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[1-[(2-hydroxy-5,6-dihydrooxaborinin-5-yl)methyl]pyrazol-3-yl]sulfonylurea |
|---|---|
| PubChem CID | 170601005 |
| Molecular Formula | C21H25BN4O5S |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[1-[(2-hydroxy-5,6-dihydrooxaborinin-5-yl)methyl]pyrazol-3-yl]sulfonylurea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)c1ccn(CC2C=CB(O)OC2)n1 |
| InChI | InChI=1S/C21H25BN4O5S/c27-21(23-20-17-5-1-3-15(17)11-16-4-2-6-18(16)20)25-32(29,30)19-8-10-26(24-19)12-14-7-9-22(28)31-13-14/h7-11,14,28H,1-6,12-13H2,(H2,23,25,27) |
| InChIKey | HAZFPKVMEHDNCD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|