C26H28FIN4O5 — CID 170602138
N-cyclopropyl-4-(2,3-dimethyl-3-nitrocyclohexa-1,5-dien-1-yl)oxy-2-(2-fluoro-4-iodoanilino)-N,1,5-trimethyl-6-oxopyridine-3-carboxamide (PubChem CID 170602138) has the molecular formula C26H28FIN4O5 and a molecular weight of 622.44 g/mol. Its IUPAC name is N-cyclopropyl-4-(2,3-dimethyl-3-nitrocyclohexa-1,5-dien-1-yl)oxy-2-(2-fluoro-4-iodoanilino)-N,1,5-trimethyl-6-oxopyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-4-(2,3-dimethyl-3-nitrocyclohexa-1,5-dien-1-yl)oxy-2-(2-fluoro-4-iodoanilino)-N,1,5-trimethyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 170602138 |
| Molecular Formula | C26H28FIN4O5 |
| Molecular Weight | 622.44 g/mol |
| Exact Mass | 622.11 |
| IUPAC Name | N-cyclopropyl-4-(2,3-dimethyl-3-nitrocyclohexa-1,5-dien-1-yl)oxy-2-(2-fluoro-4-iodoanilino)-N,1,5-trimethyl-6-oxopyridine-3-carboxamide |
| SMILES | CC1=C(Oc2c(C(=O)N(C)C3CC3)c(Nc3ccc(I)cc3F)n(C)c(=O)c2C)C=CCC1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C26H28FIN4O5/c1-14-22(37-20-7-6-12-26(3,15(20)2)32(35)36)21(25(34)30(4)17-9-10-17)23(31(5)24(14)33)29-19-11-8-16(28)13-18(19)27/h6-8,11,13,17,29H,9-10,12H2,1-5H3 |
| InChIKey | QYMFAXJODMLOCC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|