C21H20BrFN2O3 — CID 170605483
benzyl (6E)-5-[(3-bromo-2-fluorophenyl)methyl]-6-hydroxyimino-4-azaspiro[2.4]heptane-4-carboxylate (PubChem CID 170605483) has the molecular formula C21H20BrFN2O3 and a molecular weight of 447.30 g/mol. Its IUPAC name is benzyl (6E)-5-[(3-bromo-2-fluorophenyl)methyl]-6-hydroxyimino-4-azaspiro[2.4]heptane-4-carboxylate.
| Compound Name | benzyl (6E)-5-[(3-bromo-2-fluorophenyl)methyl]-6-hydroxyimino-4-azaspiro[2.4]heptane-4-carboxylate |
|---|---|
| PubChem CID | 170605483 |
| Molecular Formula | C21H20BrFN2O3 |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | benzyl (6E)-5-[(3-bromo-2-fluorophenyl)methyl]-6-hydroxyimino-4-azaspiro[2.4]heptane-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C(Cc2cccc(Br)c2F)/C(=N/O)CC12CC2 |
| InChI | InChI=1S/C21H20BrFN2O3/c22-16-8-4-7-15(19(16)23)11-18-17(24-27)12-21(9-10-21)25(18)20(26)28-13-14-5-2-1-3-6-14/h1-8,18,27H,9-13H2/b24-17+ |
| InChIKey | WGTFKYHYLIDDSZ-JJIBRWJFSA-N |
| XLogP | 4.90 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|