C20H20BrFN2O3 — CID 170605450
benzyl (3E,5R)-2-[(3-bromo-2-fluorophenyl)methyl]-3-hydroxyimino-5-methylpyrrolidine-1-carboxylate (PubChem CID 170605450) has the molecular formula C20H20BrFN2O3 and a molecular weight of 435.29 g/mol. Its IUPAC name is benzyl (3E,5R)-2-[(3-bromo-2-fluorophenyl)methyl]-3-hydroxyimino-5-methylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (3E,5R)-2-[(3-bromo-2-fluorophenyl)methyl]-3-hydroxyimino-5-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170605450 |
| Molecular Formula | C20H20BrFN2O3 |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | benzyl (3E,5R)-2-[(3-bromo-2-fluorophenyl)methyl]-3-hydroxyimino-5-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1C/C(=N\O)C(Cc2cccc(Br)c2F)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H20BrFN2O3/c1-13-10-17(23-26)18(11-15-8-5-9-16(21)19(15)22)24(13)20(25)27-12-14-6-3-2-4-7-14/h2-9,13,18,26H,10-12H2,1H3/b23-17+/t13-,18?/m1/s1 |
| InChIKey | ZWRFRMJTFLMFRI-XCBMLEBVSA-N |
| XLogP | 4.76 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|