C20H19BrF2N4O2 — CID 169173949
benzyl (2R,3S,4R)-3-azido-2-[(3-bromo-2-fluorophenyl)methyl]-4-fluoropiperidine-1-carboxylate (PubChem CID 169173949) has the molecular formula C20H19BrF2N4O2 and a molecular weight of 465.30 g/mol. Its IUPAC name is benzyl (2R,3S,4R)-3-azido-2-[(3-bromo-2-fluorophenyl)methyl]-4-fluoropiperidine-1-carboxylate.
| Compound Name | benzyl (2R,3S,4R)-3-azido-2-[(3-bromo-2-fluorophenyl)methyl]-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 169173949 |
| Molecular Formula | C20H19BrF2N4O2 |
| Molecular Weight | 465.30 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | benzyl (2R,3S,4R)-3-azido-2-[(3-bromo-2-fluorophenyl)methyl]-4-fluoropiperidine-1-carboxylate |
| SMILES | [N-]=[N+]=N[C@@H]1[C@H](F)CCN(C(=O)OCc2ccccc2)[C@@H]1Cc1cccc(Br)c1F |
| InChI | InChI=1S/C20H19BrF2N4O2/c21-15-8-4-7-14(18(15)23)11-17-19(25-26-24)16(22)9-10-27(17)20(28)29-12-13-5-2-1-3-6-13/h1-8,16-17,19H,9-12H2/t16-,17-,19-/m1/s1 |
| InChIKey | VAHXZVYLMCVAQT-ZHALLVOQSA-N |
| XLogP | 5.56 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.30 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|