C21H19BrF5NO5S — CID 169173815
benzyl (2R,3R,4R)-2-[(3-bromo-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)piperidine-1-carboxylate (PubChem CID 169173815) has the molecular formula C21H19BrF5NO5S and a molecular weight of 572.35 g/mol. Its IUPAC name is benzyl (2R,3R,4R)-2-[(3-bromo-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)piperidine-1-carboxylate.
| Compound Name | benzyl (2R,3R,4R)-2-[(3-bromo-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169173815 |
| Molecular Formula | C21H19BrF5NO5S |
| Molecular Weight | 572.35 g/mol |
| Exact Mass | 571.01 |
| IUPAC Name | benzyl (2R,3R,4R)-2-[(3-bromo-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@@H](F)[C@H](OS(=O)(=O)C(F)(F)F)[C@H]1Cc1cccc(Br)c1F |
| InChI | InChI=1S/C21H19BrF5NO5S/c22-15-8-4-7-14(18(15)24)11-17-19(33-34(30,31)21(25,26)27)16(23)9-10-28(17)20(29)32-12-13-5-2-1-3-6-13/h1-8,16-17,19H,9-12H2/t16-,17-,19+/m1/s1 |
| InChIKey | CAKARNOSEMAGQS-LMMKCTJWSA-N |
| XLogP | 5.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|